C20H21ClFN3O5S — CID 121347018
(3R)-1-(2-amino-3-ethylsulfonylphenyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 121347018) has the molecular formula C20H21ClFN3O5S and a molecular weight of 469.92 g/mol. Its IUPAC name is (3R)-1-(2-amino-3-ethylsulfonylphenyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2-amino-3-ethylsulfonylphenyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 121347018 |
| Molecular Formula | C20H21ClFN3O5S |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (3R)-1-(2-amino-3-ethylsulfonylphenyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1cccc(N2CC[C@@](O)(C(=O)NCc3cc(F)cc(Cl)c3)C2=O)c1N |
| InChI | InChI=1S/C20H21ClFN3O5S/c1-2-31(29,30)16-5-3-4-15(17(16)23)25-7-6-20(28,19(25)27)18(26)24-11-12-8-13(21)10-14(22)9-12/h3-5,8-10,28H,2,6-7,11,23H2,1H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | HIQKFTOSKRYAOX-HXUWFJFHSA-N |
| XLogP | 1.64 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|