C17H20ClFN2O4 — CID 162102706
N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(4-oxopentyl)pyrrolidine-3-carboxamide (PubChem CID 162102706) has the molecular formula C17H20ClFN2O4 and a molecular weight of 370.81 g/mol. Its IUPAC name is N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(4-oxopentyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(4-oxopentyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162102706 |
| Molecular Formula | C17H20ClFN2O4 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(4-oxopentyl)pyrrolidine-3-carboxamide |
| SMILES | CC(=O)CCCN1CCC(O)(C(=O)NCc2cc(F)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C17H20ClFN2O4/c1-11(22)3-2-5-21-6-4-17(25,16(21)24)15(23)20-10-12-7-13(18)9-14(19)8-12/h7-9,25H,2-6,10H2,1H3,(H,20,23) |
| InChIKey | ZFCFTOLLBQGEIL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|