C20H17ClFN3O3S — CID 71815117
1-(1,3-benzothiazol-2-ylmethyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 71815117) has the molecular formula C20H17ClFN3O3S and a molecular weight of 433.89 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71815117 |
| Molecular Formula | C20H17ClFN3O3S |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Cl)c1)C1(O)CCN(Cc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C20H17ClFN3O3S/c21-13-7-12(8-14(22)9-13)10-23-18(26)20(28)5-6-25(19(20)27)11-17-24-15-3-1-2-4-16(15)29-17/h1-4,7-9,28H,5-6,10-11H2,(H,23,26) |
| InChIKey | VPLAGJRFFZLEIJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|