C18H15Cl2FN2O4 — CID 118570431
[(3S)-1-(3-chlorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate (PubChem CID 118570431) has the molecular formula C18H15Cl2FN2O4 and a molecular weight of 413.23 g/mol. Its IUPAC name is [(3S)-1-(3-chlorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate.
| Compound Name | [(3S)-1-(3-chlorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118570431 |
| Molecular Formula | C18H15Cl2FN2O4 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [(3S)-1-(3-chlorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cccc(Cl)c1F)O[C@@]1(O)CCN(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H15Cl2FN2O4/c19-12-4-2-5-13(9-12)23-8-7-18(26,16(23)24)27-17(25)22-10-11-3-1-6-14(20)15(11)21/h1-6,9,26H,7-8,10H2,(H,22,25)/t18-/m0/s1 |
| InChIKey | ILLOMUPLPFXSJE-SFHVURJKSA-N |
| XLogP | 3.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|