C20H17ClF4N2O4 — CID 118570573
[(3S)-3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] N-[2-(3-chloro-5-fluorophenyl)ethyl]carbamate (PubChem CID 118570573) has the molecular formula C20H17ClF4N2O4 and a molecular weight of 460.81 g/mol. Its IUPAC name is [(3S)-3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] N-[2-(3-chloro-5-fluorophenyl)ethyl]carbamate.
| Compound Name | [(3S)-3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] N-[2-(3-chloro-5-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 118570573 |
| Molecular Formula | C20H17ClF4N2O4 |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [(3S)-3-hydroxy-2-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl] N-[2-(3-chloro-5-fluorophenyl)ethyl]carbamate |
| SMILES | O=C(NCCc1cc(F)cc(Cl)c1)O[C@@]1(O)CCN(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C20H17ClF4N2O4/c21-14-8-12(9-15(22)11-14)4-6-26-18(29)31-19(30)5-7-27(17(19)28)16-3-1-2-13(10-16)20(23,24)25/h1-3,8-11,30H,4-7H2,(H,26,29)/t19-/m0/s1 |
| InChIKey | QYHLEJMHJRFOSH-IBGZPJMESA-N |
| XLogP | 3.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|