C21H19ClFN3O6S — CID 118570376
[3-hydroxy-1-(1-methylsulfonylindol-5-yl)-2-oxopyrrolidin-3-yl] N-[(3-chloro-5-fluorophenyl)methyl]carbamate (PubChem CID 118570376) has the molecular formula C21H19ClFN3O6S and a molecular weight of 495.92 g/mol. Its IUPAC name is [3-hydroxy-1-(1-methylsulfonylindol-5-yl)-2-oxopyrrolidin-3-yl] N-[(3-chloro-5-fluorophenyl)methyl]carbamate.
| Compound Name | [3-hydroxy-1-(1-methylsulfonylindol-5-yl)-2-oxopyrrolidin-3-yl] N-[(3-chloro-5-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118570376 |
| Molecular Formula | C21H19ClFN3O6S |
| Molecular Weight | 495.92 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [3-hydroxy-1-(1-methylsulfonylindol-5-yl)-2-oxopyrrolidin-3-yl] N-[(3-chloro-5-fluorophenyl)methyl]carbamate |
| SMILES | CS(=O)(=O)n1ccc2cc(N3CCC(O)(OC(=O)NCc4cc(F)cc(Cl)c4)C3=O)ccc21 |
| InChI | InChI=1S/C21H19ClFN3O6S/c1-33(30,31)26-6-4-14-10-17(2-3-18(14)26)25-7-5-21(29,19(25)27)32-20(28)24-12-13-8-15(22)11-16(23)9-13/h2-4,6,8-11,29H,5,7,12H2,1H3,(H,24,28) |
| InChIKey | VDHMKHKNMXQSOA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.92 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|