C18H16F2N2O4 — CID 118570607
[(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3,5-difluorophenyl)methyl]carbamate (PubChem CID 118570607) has the molecular formula C18H16F2N2O4 and a molecular weight of 362.33 g/mol. Its IUPAC name is [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3,5-difluorophenyl)methyl]carbamate.
| Compound Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3,5-difluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118570607 |
| Molecular Formula | C18H16F2N2O4 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3,5-difluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cc(F)cc(F)c1)O[C@@]1(O)CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H16F2N2O4/c19-13-8-12(9-14(20)10-13)11-21-17(24)26-18(25)6-7-22(16(18)23)15-4-2-1-3-5-15/h1-5,8-10,25H,6-7,11H2,(H,21,24)/t18-/m0/s1 |
| InChIKey | RIIJDAOKVCMAGZ-SFHVURJKSA-N |
| XLogP | 2.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|