C20H15F7N2O4 — CID 118570495
[(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 118570495) has the molecular formula C20H15F7N2O4 and a molecular weight of 480.34 g/mol. Its IUPAC name is [(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | [(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118570495 |
| Molecular Formula | C20H15F7N2O4 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)O[C@@]1(O)CCN(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H15F7N2O4/c21-14-1-3-15(4-2-14)29-6-5-18(32,16(29)30)33-17(31)28-10-11-7-12(19(22,23)24)9-13(8-11)20(25,26)27/h1-4,7-9,32H,5-6,10H2,(H,28,31)/t18-/m0/s1 |
| InChIKey | MPGYEAXUUKCLLG-SFHVURJKSA-N |
| XLogP | 4.22 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|