C18H14ClF3N2O4 — CID 118570499
[(3S)-1-(2,4-difluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate (PubChem CID 118570499) has the molecular formula C18H14ClF3N2O4 and a molecular weight of 414.77 g/mol. Its IUPAC name is [(3S)-1-(2,4-difluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate.
| Compound Name | [(3S)-1-(2,4-difluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118570499 |
| Molecular Formula | C18H14ClF3N2O4 |
| Molecular Weight | 414.77 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [(3S)-1-(2,4-difluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-chloro-2-fluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cccc(Cl)c1F)O[C@@]1(O)CCN(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C18H14ClF3N2O4/c19-12-3-1-2-10(15(12)22)9-23-17(26)28-18(27)6-7-24(16(18)25)14-5-4-11(20)8-13(14)21/h1-5,8,27H,6-7,9H2,(H,23,26)/t18-/m0/s1 |
| InChIKey | YTJVWNOVQMDKRY-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|