C19H18Cl2N4O2 — CID 118571504
3-[2-(1-aminobutyl)-5,8-dichloro-4-oxoquinazolin-3-yl]benzamide (PubChem CID 118571504) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 3-[2-(1-aminobutyl)-5,8-dichloro-4-oxoquinazolin-3-yl]benzamide.
| Compound Name | 3-[2-(1-aminobutyl)-5,8-dichloro-4-oxoquinazolin-3-yl]benzamide |
|---|---|
| PubChem CID | 118571504 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[2-(1-aminobutyl)-5,8-dichloro-4-oxoquinazolin-3-yl]benzamide |
| SMILES | CCCC(N)c1nc2c(Cl)ccc(Cl)c2c(=O)n1-c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C19H18Cl2N4O2/c1-2-4-14(22)18-24-16-13(21)8-7-12(20)15(16)19(27)25(18)11-6-3-5-10(9-11)17(23)26/h3,5-9,14H,2,4,22H2,1H3,(H2,23,26) |
| InChIKey | OIEUMSSQSYXIFJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |