C24H21BrCl2N2O3 — CID 118572054
7-bromo-5,8-dichloro-2-[(4-methoxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 118572054) has the molecular formula C24H21BrCl2N2O3 and a molecular weight of 536.25 g/mol. Its IUPAC name is 7-bromo-5,8-dichloro-2-[(4-methoxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-bromo-5,8-dichloro-2-[(4-methoxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 118572054 |
| Molecular Formula | C24H21BrCl2N2O3 |
| Molecular Weight | 536.25 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | 7-bromo-5,8-dichloro-2-[(4-methoxy-6-methyl-2-phenylmethoxy-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc(C)nc(OCc2ccccc2)c1CN1CCc2c(Cl)cc(Br)c(Cl)c2C1=O |
| InChI | InChI=1S/C24H21BrCl2N2O3/c1-14-10-20(31-2)17(23(28-14)32-13-15-6-4-3-5-7-15)12-29-9-8-16-19(26)11-18(25)22(27)21(16)24(29)30/h3-7,10-11H,8-9,12-13H2,1-2H3 |
| InChIKey | DWWIRJUBYWYGQA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.25 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|