C24H23BrN2O3 — CID 166572592
7-(bromomethyl)-2-[(4-methoxy-2-pyridinyl)methyl]-5-phenylmethoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 166572592) has the molecular formula C24H23BrN2O3 and a molecular weight of 467.36 g/mol. Its IUPAC name is 7-(bromomethyl)-2-[(4-methoxy-2-pyridinyl)methyl]-5-phenylmethoxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-(bromomethyl)-2-[(4-methoxy-2-pyridinyl)methyl]-5-phenylmethoxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 166572592 |
| Molecular Formula | C24H23BrN2O3 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 7-(bromomethyl)-2-[(4-methoxy-2-pyridinyl)methyl]-5-phenylmethoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccnc(CN2CCc3c(OCc4ccccc4)cc(CBr)cc3C2=O)c1 |
| InChI | InChI=1S/C24H23BrN2O3/c1-29-20-7-9-26-19(13-20)15-27-10-8-21-22(24(27)28)11-18(14-25)12-23(21)30-16-17-5-3-2-4-6-17/h2-7,9,11-13H,8,10,14-16H2,1H3 |
| InChIKey | DTNZJPJPRDVCGI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|