C36H41ClN2O5 — CID 175964050
9-chloro-6-[(4,6-dimethyl-2-phenylmethoxy-3-pyridinyl)methyl]-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2,4-dimethyl-7,8-dihydro-3H-furo[2,3-g]isoquinolin-5-one (PubChem CID 175964050) has the molecular formula C36H41ClN2O5 and a molecular weight of 617.19 g/mol. Its IUPAC name is 9-chloro-6-[(4,6-dimethyl-2-phenylmethoxy-3-pyridinyl)methyl]-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2,4-dimethyl-7,8-dihydro-3H-furo[2,3-g]isoquinolin-5-one.
| Compound Name | 9-chloro-6-[(4,6-dimethyl-2-phenylmethoxy-3-pyridinyl)methyl]-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2,4-dimethyl-7,8-dihydro-3H-furo[2,3-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 175964050 |
| Molecular Formula | C36H41ClN2O5 |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 9-chloro-6-[(4,6-dimethyl-2-phenylmethoxy-3-pyridinyl)methyl]-2-(1,4-dioxaspiro[4.5]decan-8-yl)-2,4-dimethyl-7,8-dihydro-3H-furo[2,3-g]isoquinolin-5-one |
| SMILES | Cc1cc(C)c(CN2CCc3c(Cl)c4c(c(C)c3C2=O)CC(C)(C2CCC3(CC2)OCCO3)O4)c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C36H41ClN2O5/c1-22-18-23(2)38-33(41-21-25-8-6-5-7-9-25)29(22)20-39-15-12-27-30(34(39)40)24(3)28-19-35(4,44-32(28)31(27)37)26-10-13-36(14-11-26)42-16-17-43-36/h5-9,18,26H,10-17,19-21H2,1-4H3 |
| InChIKey | VGXWNUARNWWZLQ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |