C15H9FN4 — CID 118577050
1-fluoro-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine (PubChem CID 118577050) has the molecular formula C15H9FN4 and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-fluoro-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine.
| Compound Name | 1-fluoro-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine |
|---|---|
| PubChem CID | 118577050 |
| Molecular Formula | C15H9FN4 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-fluoro-7-pyrrolo[2,3-c]pyridin-1-yl-2,6-naphthyridine |
| SMILES | Fc1nccc2cnc(-n3ccc4ccncc43)cc12 |
| InChI | InChI=1S/C15H9FN4/c16-15-12-7-14(19-8-11(12)2-5-18-15)20-6-3-10-1-4-17-9-13(10)20/h1-9H |
| InChIKey | MNSFGFBKTJQOGY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|