C10H19NO3 — CID 118577691
methyl 3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate (PubChem CID 118577691) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate.
| Compound Name | methyl 3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 118577691 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl 3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate |
| SMILES | COC(=O)C(C)C(OC)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H19NO3/c1-7(10(12)14-3)9(13-2)8-5-4-6-11-8/h7-9,11H,4-6H2,1-3H3/t7?,8-,9?/m0/s1 |
| InChIKey | WUNJYMIULWQVAH-MGURRDGZSA-N |
| XLogP | 0.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |