C18H32N2O3 — CID 145321333
(2R,3R)-N-[(E,2R,3S)-4-ethenyl-3-hydroxyhept-4-en-2-yl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide (PubChem CID 145321333) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2R,3R)-N-[(E,2R,3S)-4-ethenyl-3-hydroxyhept-4-en-2-yl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide.
| Compound Name | (2R,3R)-N-[(E,2R,3S)-4-ethenyl-3-hydroxyhept-4-en-2-yl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide |
|---|---|
| PubChem CID | 145321333 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | (2R,3R)-N-[(E,2R,3S)-4-ethenyl-3-hydroxyhept-4-en-2-yl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide |
| SMILES | C=C/C(=C\CC)[C@H](O)[C@@H](C)NC(=O)[C@H](C)[C@@H](OC)[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H32N2O3/c1-6-9-14(7-2)16(21)13(4)20-18(22)12(3)17(23-5)15-10-8-11-19-15/h7,9,12-13,15-17,19,21H,2,6,8,10-11H2,1,3-5H3,(H,20,22)/b14-9+/t12-,13-,15+,16-,17-/m1/s1 |
| InChIKey | AZPFISJMRSJNQV-DPBJXHIESA-N |
| XLogP | 1.78 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|