C16H18N4O — CID 118578495
1,4-diazatricyclo[4.3.1.03,7]decan-4-yl(1H-indazol-3-yl)methanone (PubChem CID 118578495) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1,4-diazatricyclo[4.3.1.03,7]decan-4-yl(1H-indazol-3-yl)methanone.
| Compound Name | 1,4-diazatricyclo[4.3.1.03,7]decan-4-yl(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 118578495 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1,4-diazatricyclo[4.3.1.03,7]decan-4-yl(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CC2CN3CCC2C1C3 |
| InChI | InChI=1S/C16H18N4O/c21-16(15-12-3-1-2-4-13(12)17-18-15)20-8-10-7-19-6-5-11(10)14(20)9-19/h1-4,10-11,14H,5-9H2,(H,17,18) |
| InChIKey | BSVVBTVKZZNNPT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |