C13H19NOS — CID 118579454
3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole (PubChem CID 118579454) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole.
| Compound Name | 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 118579454 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole |
| SMILES | CCCCCCc1noc2c(C)sc(C)c12 |
| InChI | InChI=1S/C13H19NOS/c1-4-5-6-7-8-11-12-9(2)16-10(3)13(12)15-14-11/h4-8H2,1-3H3 |
| InChIKey | WVUAQZGARODKEV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|