About 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole
3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole (PubChem CID 118579454) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole.
Molecular Properties
| Compound Name | 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole |
| PubChem CID | 118579454 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole |
| SMILES | CCCCCCc1noc2c(C)sc(C)c12 |
| InChI | InChI=1S/C13H19NOS/c1-4-5-6-7-8-11-12-9(2)16-10(3)13(12)15-14-11/h4-8H2,1-3H3 |
| InChIKey | WVUAQZGARODKEV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole?
The IUPAC name of 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole (CID 118579454) is 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole.
What is the SMILES notation for 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole?
The canonical SMILES for 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole is CCCCCCc1noc2c(C)sc(C)c12.
What is the InChIKey of 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole?
The InChIKey is WVUAQZGARODKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-4-5-6-7-8-11-12-9(2)16-10(3)13(12)15-14-11/h4-8H2,1-3H3.
What are the key properties of 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole?
3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole has a molecular weight of 237.37 g/mol, XLogP of 4.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-4,6-dimethylthieno[3,4-d][1,2]oxazole is sourced from PubChem (CID 118579454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).