C15H27NS — CID 118579683
4-ethyl-2,5-bis(2-methylbutan-2-yl)-1,3-thiazole (PubChem CID 118579683) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 4-ethyl-2,5-bis(2-methylbutan-2-yl)-1,3-thiazole.
| Compound Name | 4-ethyl-2,5-bis(2-methylbutan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 118579683 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 4-ethyl-2,5-bis(2-methylbutan-2-yl)-1,3-thiazole |
| SMILES | CCc1nc(C(C)(C)CC)sc1C(C)(C)CC |
| InChI | InChI=1S/C15H27NS/c1-8-11-12(14(4,5)9-2)17-13(16-11)15(6,7)10-3/h8-10H2,1-7H3 |
| InChIKey | YVTQPHHDSPFBLZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |