About 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole
2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole (PubChem CID 118900466) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole |
| PubChem CID | 118900466 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole |
| SMILES | CCC(C)(C)c1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C11H20N2S/c1-7-11(5,6)9-13-12-8(14-9)10(2,3)4/h7H2,1-6H3 |
| InChIKey | GKRFNEAVTCYIPK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole?
The IUPAC name of 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole (CID 118900466) is 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole?
The canonical SMILES for 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole is CCC(C)(C)c1nnc(C(C)(C)C)s1.
What is the InChIKey of 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole?
The InChIKey is GKRFNEAVTCYIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-7-11(5,6)9-13-12-8(14-9)10(2,3)4/h7H2,1-6H3.
What are the key properties of 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole?
2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole has a molecular weight of 212.36 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2-methylbutan-2-yl)-1,3,4-thiadiazole is sourced from PubChem (CID 118900466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).