C7H13ClN4S — CID 141354172
5-tert-butyl-1,3,4-thiadiazole-2-carboximidamide;hydrochloride (PubChem CID 141354172) has the molecular formula C7H13ClN4S and a molecular weight of 220.73 g/mol. Its IUPAC name is 5-tert-butyl-1,3,4-thiadiazole-2-carboximidamide;hydrochloride.
| Compound Name | 5-tert-butyl-1,3,4-thiadiazole-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 141354172 |
| Molecular Formula | C7H13ClN4S |
| Molecular Weight | 220.73 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 5-tert-butyl-1,3,4-thiadiazole-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C7H12N4S.ClH/c1-7(2,3)6-11-10-5(12-6)4(8)9;/h1-3H3,(H3,8,9);1H |
| InChIKey | QIFDQQVBJMWGSK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.73 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|