C10H19N3OS — CID 133434609
(2S)-2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol (PubChem CID 133434609) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is (2S)-2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol.
| Compound Name | (2S)-2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 133434609 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (2S)-2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol |
| SMILES | CC[C@@H](CO)Nc1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C10H19N3OS/c1-5-7(6-14)11-9-13-12-8(15-9)10(2,3)4/h7,14H,5-6H2,1-4H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | DMWNDBCOEVBZCB-ZETCQYMHSA-N |
| XLogP | 2.02 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |