C8H6F2N2O2 — CID 118580071
1-(2,6-difluoro-3-nitrophenyl)ethanimine (PubChem CID 118580071) has the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-nitrophenyl)ethanimine.
| Compound Name | 1-(2,6-difluoro-3-nitrophenyl)ethanimine |
|---|---|
| PubChem CID | 118580071 |
| Molecular Formula | C8H6F2N2O2 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-(2,6-difluoro-3-nitrophenyl)ethanimine |
| SMILES | [H]/N=C(\C)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C8H6F2N2O2/c1-4(11)7-5(9)2-3-6(8(7)10)12(13)14/h2-3,11H,1H3/b11-4+ |
| InChIKey | SLWLJUBBSWOWCX-NYYWCZLTSA-N |
| XLogP | 2.26 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|