C19H14N2O3S — CID 118583145
(E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 118583145) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 118583145 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)Nc2ccc3c(c2)S(=O)(=O)C=C3)cc1 |
| InChI | InChI=1S/C19H14N2O3S/c1-13-2-4-14(5-3-13)10-16(12-20)19(22)21-17-7-6-15-8-9-25(23,24)18(15)11-17/h2-11H,1H3,(H,21,22)/b16-10+ |
| InChIKey | HAUUTBSEWHHILD-MHWRWJLKSA-N |
| XLogP | 3.30 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|