C19H14N2O4S — CID 77107180
(E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 77107180) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 77107180 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C(\C#N)C(=O)Nc1ccc2c(c1)S(=O)(=O)C=C2 |
| InChI | InChI=1S/C19H14N2O4S/c1-25-17-5-3-2-4-14(17)10-15(12-20)19(22)21-16-7-6-13-8-9-26(23,24)18(13)11-16/h2-11H,1H3,(H,21,22)/b15-10+ |
| InChIKey | SPWXSLXDYGYRIH-XNTDXEJSSA-N |
| XLogP | 3.00 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|