C21H12N4O3S — CID 118571098
(Z)-2-cyano-3-(5-cyano-1H-indol-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide (PubChem CID 118571098) has the molecular formula C21H12N4O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(5-cyano-1H-indol-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(5-cyano-1H-indol-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 118571098 |
| Molecular Formula | C21H12N4O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (Z)-2-cyano-3-(5-cyano-1H-indol-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1c[nH]c2ccc(C#N)cc12)C(=O)Nc1ccc2c(c1)S(=O)(=O)C=C2 |
| InChI | InChI=1S/C21H12N4O3S/c22-10-13-1-4-19-18(7-13)16(12-24-19)8-15(11-23)21(26)25-17-3-2-14-5-6-29(27,28)20(14)9-17/h1-9,12,24H,(H,25,26)/b15-8- |
| InChIKey | SLMGNEOUWLXUHN-NVNXTCNLSA-N |
| XLogP | 3.34 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|