C20H11N5O3S — CID 129179579
(E)-2-cyano-3-(5-cyano-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide (PubChem CID 129179579) has the molecular formula C20H11N5O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is (E)-2-cyano-3-(5-cyano-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(5-cyano-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 129179579 |
| Molecular Formula | C20H11N5O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (E)-2-cyano-3-(5-cyano-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(1,1-dioxo-1-benzothiophen-6-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c[nH]c2ncc(C#N)cc12)C(=O)Nc1ccc2c(c1)S(=O)(=O)C=C2 |
| InChI | InChI=1S/C20H11N5O3S/c21-8-12-5-17-15(11-24-19(17)23-10-12)6-14(9-22)20(26)25-16-2-1-13-3-4-29(27,28)18(13)7-16/h1-7,10-11H,(H,23,24)(H,25,26)/b14-6+ |
| InChIKey | PRJYYJDZRDHESN-MKMNVTDBSA-N |
| XLogP | 2.74 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|