C18H12N2O4S — CID 77107179
(E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 77107179) has the molecular formula C18H12N2O4S and a molecular weight of 352.37 g/mol. Its IUPAC name is (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 77107179 |
| Molecular Formula | C18H12N2O4S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (E)-2-cyano-N-(1,1-dioxo-1-benzothiophen-6-yl)-3-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(O)cc1)C(=O)Nc1ccc2c(c1)S(=O)(=O)C=C2 |
| InChI | InChI=1S/C18H12N2O4S/c19-11-14(9-12-1-5-16(21)6-2-12)18(22)20-15-4-3-13-7-8-25(23,24)17(13)10-15/h1-10,21H,(H,20,22)/b14-9+ |
| InChIKey | OIKOYJJGESJYCR-NTEUORMPSA-N |
| XLogP | 2.70 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|