C5H9NOS — CID 118586381
1-[(4R)-1,3-thiazolidin-4-yl]ethenol (PubChem CID 118586381) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is 1-[(4R)-1,3-thiazolidin-4-yl]ethenol.
| Compound Name | 1-[(4R)-1,3-thiazolidin-4-yl]ethenol |
|---|---|
| PubChem CID | 118586381 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 1-[(4R)-1,3-thiazolidin-4-yl]ethenol |
| SMILES | C=C(O)[C@@H]1CSCN1 |
| InChI | InChI=1S/C5H9NOS/c1-4(7)5-2-8-3-6-5/h5-7H,1-3H2/t5-/m0/s1 |
| InChIKey | CJEBDFUQCPMGPF-YFKPBYRVSA-N |
| XLogP | 0.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|