C25H16F4N2O3 — CID 118586642
2-fluoro-5-[3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid (PubChem CID 118586642) has the molecular formula C25H16F4N2O3 and a molecular weight of 468.41 g/mol. Its IUPAC name is 2-fluoro-5-[3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid.
| Compound Name | 2-fluoro-5-[3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 118586642 |
| Molecular Formula | C25H16F4N2O3 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-fluoro-5-[3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc(-c3cccc(-c4ccc(F)c(C(=O)O)c4)c3)n2)cc1 |
| InChI | InChI=1S/C25H16F4N2O3/c1-34-18-8-5-14(6-9-18)21-13-22(25(27,28)29)31-23(30-21)17-4-2-3-15(11-17)16-7-10-20(26)19(12-16)24(32)33/h2-13H,1H3,(H,32,33) |
| InChIKey | JXICSEYDVDNXAK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |