C32H31ClF2N2O5 — CID 118587960
2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenyl]-2,2-difluoroacetic acid (PubChem CID 118587960) has the molecular formula C32H31ClF2N2O5 and a molecular weight of 597.06 g/mol. Its IUPAC name is 2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenyl]-2,2-difluoroacetic acid.
| Compound Name | 2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenyl]-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 118587960 |
| Molecular Formula | C32H31ClF2N2O5 |
| Molecular Weight | 597.06 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 2-[3-[2-[[(3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]phenyl]-2,2-difluoroacetic acid |
| SMILES | O=C(NCCc1cccc(C(F)(F)C(=O)O)c1)[C@@H]1c2ccccc2C(=O)N([C@H]2CCCC[C@@H]2O)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H31ClF2N2O5/c33-22-14-12-20(13-15-22)28-27(29(39)36-17-16-19-6-5-7-21(18-19)32(34,35)31(41)42)23-8-1-2-9-24(23)30(40)37(28)25-10-3-4-11-26(25)38/h1-2,5-9,12-15,18,25-28,38H,3-4,10-11,16-17H2,(H,36,39)(H,41,42)/t25-,26-,27+,28-/m0/s1 |
| InChIKey | PJQKAHBMVAYTLG-BPXGVECKSA-N |
| XLogP | 5.46 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.06 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |