C27H28Cl2N4O3 — CID 59478428
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyrazol-1-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478428) has the molecular formula C27H28Cl2N4O3 and a molecular weight of 527.45 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyrazol-1-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyrazol-1-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478428 |
| Molecular Formula | C27H28Cl2N4O3 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-N-(2-pyrazol-1-ylethyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NCCn1cccn1)[C@@H]1c2ccccc2C(=O)N([C@H]2CCCC[C@@H]2O)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H28Cl2N4O3/c28-17-10-11-20(21(29)16-17)25-24(26(35)30-13-15-32-14-5-12-31-32)18-6-1-2-7-19(18)27(36)33(25)22-8-3-4-9-23(22)34/h1-2,5-7,10-12,14,16,22-25,34H,3-4,8-9,13,15H2,(H,30,35)/t22-,23-,24+,25-/m0/s1 |
| InChIKey | JVRVSGJLWVPYEU-JBXUNAHCSA-N |
| XLogP | 4.59 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |