C33H36Cl2N2O5S — CID 59478371
tert-butyl 3-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]thiophene-2-carboxylate (PubChem CID 59478371) has the molecular formula C33H36Cl2N2O5S and a molecular weight of 643.63 g/mol. Its IUPAC name is tert-butyl 3-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]thiophene-2-carboxylate.
| Compound Name | tert-butyl 3-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59478371 |
| Molecular Formula | C33H36Cl2N2O5S |
| Molecular Weight | 643.63 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | tert-butyl 3-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-hydroxycyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]thiophene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1sccc1CCNC(=O)[C@@H]1c2ccccc2C(=O)N([C@H]2CCCC[C@@H]2O)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H36Cl2N2O5S/c1-33(2,3)42-32(41)29-19(15-17-43-29)14-16-36-30(39)27-21-8-4-5-9-22(21)31(40)37(25-10-6-7-11-26(25)38)28(27)23-13-12-20(34)18-24(23)35/h4-5,8-9,12-13,15,17-18,25-28,38H,6-7,10-11,14,16H2,1-3H3,(H,36,39)/t25-,26-,27+,28-/m0/s1 |
| InChIKey | YMDGXYFVWMRKFT-BPXGVECKSA-N |
| XLogP | 6.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |