C31H32Cl2N2O3 — CID 59478759
(3R,4R)-3-(2,4-dichlorophenyl)-2-(4-hydroxycyclohexyl)-1-oxo-N-(3-phenylpropyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478759) has the molecular formula C31H32Cl2N2O3 and a molecular weight of 551.51 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-(4-hydroxycyclohexyl)-1-oxo-N-(3-phenylpropyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-(4-hydroxycyclohexyl)-1-oxo-N-(3-phenylpropyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478759 |
| Molecular Formula | C31H32Cl2N2O3 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-(4-hydroxycyclohexyl)-1-oxo-N-(3-phenylpropyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1c2ccccc2C(=O)N(C2CCC(O)CC2)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H32Cl2N2O3/c32-21-12-17-26(27(33)19-21)29-28(30(37)34-18-6-9-20-7-2-1-3-8-20)24-10-4-5-11-25(24)31(38)35(29)22-13-15-23(36)16-14-22/h1-5,7-8,10-12,17,19,22-23,28-29,36H,6,9,13-16,18H2,(H,34,37)/t22?,23?,28-,29+/m1/s1 |
| InChIKey | CYWHBCGRKFFBFG-MERSLPLPSA-N |
| XLogP | 6.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|