C8H21NO4PS+ — CID 118588472
dimethyl-(2-phosphonooxyethyl)-(4-sulfanylbutyl)azanium (PubChem CID 118588472) has the molecular formula C8H21NO4PS+ and a molecular weight of 258.30 g/mol. Its IUPAC name is dimethyl-(2-phosphonooxyethyl)-(4-sulfanylbutyl)azanium.
| Compound Name | dimethyl-(2-phosphonooxyethyl)-(4-sulfanylbutyl)azanium |
|---|---|
| PubChem CID | 118588472 |
| Molecular Formula | C8H21NO4PS+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | dimethyl-(2-phosphonooxyethyl)-(4-sulfanylbutyl)azanium |
| SMILES | C[N+](C)(CCCCS)CCOP(=O)(O)O |
| InChI | InChI=1S/C8H20NO4PS/c1-9(2,5-3-4-8-15)6-7-13-14(10,11)12/h3-8H2,1-2H3,(H2-,10,11,12,15)/p+1 |
| InChIKey | FIVHWOKSYQVWCT-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|