C16H24F3NO2 — CID 118588929
3-amino-1,1,1-trifluoro-2-(4-methoxyphenyl)nonan-2-ol (PubChem CID 118588929) has the molecular formula C16H24F3NO2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(4-methoxyphenyl)nonan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-(4-methoxyphenyl)nonan-2-ol |
|---|---|
| PubChem CID | 118588929 |
| Molecular Formula | C16H24F3NO2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(4-methoxyphenyl)nonan-2-ol |
| SMILES | CCCCCCC(N)C(O)(c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H24F3NO2/c1-3-4-5-6-7-14(20)15(21,16(17,18)19)12-8-10-13(22-2)11-9-12/h8-11,14,21H,3-7,20H2,1-2H3 |
| InChIKey | VSTIOKMZLXFLMZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|