C15H25NO2 — CID 118589556
(2S)-2,4-dimethyl-5-octanoyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 118589556) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-5-octanoyl-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | (2S)-2,4-dimethyl-5-octanoyl-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 118589556 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (2S)-2,4-dimethyl-5-octanoyl-2,3-dihydro-1H-pyridin-6-one |
| SMILES | CCCCCCCC(=O)C1=C(C)C[C@H](C)NC1=O |
| InChI | InChI=1S/C15H25NO2/c1-4-5-6-7-8-9-13(17)14-11(2)10-12(3)16-15(14)18/h12H,4-10H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | ZNDPOFXYUIQWPY-LBPRGKRZSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|