C19H35NO2 — CID 78320256
(3R,4R,6S)-3-dodecanoyl-4,6-dimethylpiperidin-2-one (PubChem CID 78320256) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is (3R,4R,6S)-3-dodecanoyl-4,6-dimethylpiperidin-2-one.
| Compound Name | (3R,4R,6S)-3-dodecanoyl-4,6-dimethylpiperidin-2-one |
|---|---|
| PubChem CID | 78320256 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | (3R,4R,6S)-3-dodecanoyl-4,6-dimethylpiperidin-2-one |
| SMILES | CCCCCCCCCCCC(=O)[C@@H]1C(=O)N[C@@H](C)C[C@H]1C |
| InChI | InChI=1S/C19H35NO2/c1-4-5-6-7-8-9-10-11-12-13-17(21)18-15(2)14-16(3)20-19(18)22/h15-16,18H,4-14H2,1-3H3,(H,20,22)/t15-,16+,18-/m1/s1 |
| InChIKey | SOFLFFXISVCOAN-SOLBZPMBSA-N |
| XLogP | 4.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|