C20H17ClF3N5 — CID 118590255
6-(3-chlorophenyl)-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine-2-carbonitrile (PubChem CID 118590255) has the molecular formula C20H17ClF3N5 and a molecular weight of 419.84 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine-2-carbonitrile.
| Compound Name | 6-(3-chlorophenyl)-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine-2-carbonitrile |
|---|---|
| PubChem CID | 118590255 |
| Molecular Formula | C20H17ClF3N5 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 6-(3-chlorophenyl)-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine-2-carbonitrile |
| SMILES | N#Cc1nc(-c2cccc(Cl)c2)c2c(ncn2CC2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C20H17ClF3N5/c21-15-3-1-2-13(8-15)17-18-19(28-16(9-25)27-17)26-11-29(18)10-12-4-6-14(7-5-12)20(22,23)24/h1-3,8,11-12,14H,4-7,10H2 |
| InChIKey | MOXCDYVTCWSPFC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |