C13H13Cl2F3N4 — CID 90325410
2,6-dichloro-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine (PubChem CID 90325410) has the molecular formula C13H13Cl2F3N4 and a molecular weight of 353.18 g/mol. Its IUPAC name is 2,6-dichloro-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine.
| Compound Name | 2,6-dichloro-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine |
|---|---|
| PubChem CID | 90325410 |
| Molecular Formula | C13H13Cl2F3N4 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2,6-dichloro-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purine |
| SMILES | FC(F)(F)C1CCC(Cn2cnc3nc(Cl)nc(Cl)c32)CC1 |
| InChI | InChI=1S/C13H13Cl2F3N4/c14-10-9-11(21-12(15)20-10)19-6-22(9)5-7-1-3-8(4-2-7)13(16,17)18/h6-8H,1-5H2 |
| InChIKey | GYVXPRRFVUNRQG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |