C10H9Cl2N3 — CID 118288394
5,6-dichloro-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine (PubChem CID 118288394) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is 5,6-dichloro-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 118288394 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 5,6-dichloro-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2ncn(CC3CC3)c2nc1Cl |
| InChI | InChI=1S/C10H9Cl2N3/c11-7-3-8-10(14-9(7)12)15(5-13-8)4-6-1-2-6/h3,5-6H,1-2,4H2 |
| InChIKey | NCZFPRQKMSBUCR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|