C13H14Cl2F2N4 — CID 118558734
2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine (PubChem CID 118558734) has the molecular formula C13H14Cl2F2N4 and a molecular weight of 335.19 g/mol. Its IUPAC name is 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine.
| Compound Name | 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine |
|---|---|
| PubChem CID | 118558734 |
| Molecular Formula | C13H14Cl2F2N4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine |
| SMILES | CC1CCC(Cn2cnc3nc(Cl)nc(Cl)c32)CC1(F)F |
| InChI | InChI=1S/C13H14Cl2F2N4/c1-7-2-3-8(4-13(7,16)17)5-21-6-18-11-9(21)10(14)19-12(15)20-11/h6-8H,2-5H2,1H3 |
| InChIKey | YMQGTAZUKLMDPH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |