About 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine
2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine (PubChem CID 118558734) has the molecular formula C13H14Cl2F2N4
and a molecular weight of 335.19 g/mol. Its IUPAC name is 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine.
Molecular Properties
| Compound Name | 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine |
| PubChem CID | 118558734 |
| Molecular Formula | C13H14Cl2F2N4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine |
| SMILES | CC1CCC(Cn2cnc3nc(Cl)nc(Cl)c32)CC1(F)F |
| InChI | InChI=1S/C13H14Cl2F2N4/c1-7-2-3-8(4-13(7,16)17)5-21-6-18-11-9(21)10(14)19-12(15)20-11/h6-8H,2-5H2,1H3 |
| InChIKey | YMQGTAZUKLMDPH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine?
The IUPAC name of 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine (CID 118558734) is 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine.
What is the SMILES notation for 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine?
The canonical SMILES for 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine is CC1CCC(Cn2cnc3nc(Cl)nc(Cl)c32)CC1(F)F.
What is the InChIKey of 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine?
The InChIKey is YMQGTAZUKLMDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2F2N4/c1-7-2-3-8(4-13(7,16)17)5-21-6-18-11-9(21)10(14)19-12(15)20-11/h6-8H,2-5H2,1H3.
What are the key properties of 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine?
2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine has a molecular weight of 335.19 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-7-[(3,3-difluoro-4-methylcyclohexyl)methyl]purine is sourced from PubChem (CID 118558734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).