C20H23ClN4 — CID 118558698
2-chloro-7-[(4-methylcyclohexyl)methyl]-6-(3-methylphenyl)purine (PubChem CID 118558698) has the molecular formula C20H23ClN4 and a molecular weight of 354.89 g/mol. Its IUPAC name is 2-chloro-7-[(4-methylcyclohexyl)methyl]-6-(3-methylphenyl)purine.
| Compound Name | 2-chloro-7-[(4-methylcyclohexyl)methyl]-6-(3-methylphenyl)purine |
|---|---|
| PubChem CID | 118558698 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-chloro-7-[(4-methylcyclohexyl)methyl]-6-(3-methylphenyl)purine |
| SMILES | Cc1cccc(-c2nc(Cl)nc3ncn(CC4CCC(C)CC4)c23)c1 |
| InChI | InChI=1S/C20H23ClN4/c1-13-6-8-15(9-7-13)11-25-12-22-19-18(25)17(23-20(21)24-19)16-5-3-4-14(2)10-16/h3-5,10,12-13,15H,6-9,11H2,1-2H3 |
| InChIKey | ROHBCTRFIOEIFK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |