C15H17IN2S — CID 11859067
2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-4-(123I)iodo(123I)aniline (PubChem CID 11859067) has the molecular formula C15H17IN2S and a molecular weight of 380.29 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-4-(123I)iodo(123I)aniline.
| Compound Name | 2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-4-(123I)iodo(123I)aniline |
|---|---|
| PubChem CID | 11859067 |
| Molecular Formula | C15H17IN2S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-4-(123I)iodo(123I)aniline |
| SMILES | CN(C)Cc1ccccc1Sc1cc([123I])ccc1N |
| InChI | InChI=1S/C15H17IN2S/c1-18(2)10-11-5-3-4-6-14(11)19-15-9-12(16)7-8-13(15)17/h3-9H,10,17H2,1-2H3/i16-4 |
| InChIKey | ABUPLMQWBXTJQL-KIWWSDKQSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|