C17H18N2S — CID 11818392
1-[2-(1H-indol-3-ylsulfanyl)phenyl]-N,N-dimethylmethanamine (PubChem CID 11818392) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-ylsulfanyl)phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(1H-indol-3-ylsulfanyl)phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 11818392 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[2-(1H-indol-3-ylsulfanyl)phenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1Sc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H18N2S/c1-19(2)12-13-7-3-6-10-16(13)20-17-11-18-15-9-5-4-8-14(15)17/h3-11,18H,12H2,1-2H3 |
| InChIKey | FXSKEXHBCPXRRY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |