C12H10N2OS — CID 138964423
4-(1H-indol-3-ylsulfanyl)-3-methyl-1,2-oxazole (PubChem CID 138964423) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-(1H-indol-3-ylsulfanyl)-3-methyl-1,2-oxazole.
| Compound Name | 4-(1H-indol-3-ylsulfanyl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 138964423 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-(1H-indol-3-ylsulfanyl)-3-methyl-1,2-oxazole |
| SMILES | Cc1nocc1Sc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H10N2OS/c1-8-12(7-15-14-8)16-11-6-13-10-5-3-2-4-9(10)11/h2-7,13H,1H3 |
| InChIKey | UDTTYPWLBUAFRZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |