About 3-methyl-1H-indole;N-methylmethanamine
3-methyl-1H-indole;N-methylmethanamine (PubChem CID 68994741) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-methyl-1H-indole;N-methylmethanamine.
Molecular Properties
| Compound Name | 3-methyl-1H-indole;N-methylmethanamine |
| PubChem CID | 68994741 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-methyl-1H-indole;N-methylmethanamine |
| SMILES | CNC.Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H9N.C2H7N/c1-7-6-10-9-5-3-2-4-8(7)9;1-3-2/h2-6,10H,1H3;3H,1-2H3 |
| InChIKey | IBHRJTTUOZMKMG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-1H-indole;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-indole;N-methylmethanamine?
The IUPAC name of 3-methyl-1H-indole;N-methylmethanamine (CID 68994741) is 3-methyl-1H-indole;N-methylmethanamine.
What is the SMILES notation for 3-methyl-1H-indole;N-methylmethanamine?
The canonical SMILES for 3-methyl-1H-indole;N-methylmethanamine is CNC.Cc1c[nH]c2ccccc12.
What is the InChIKey of 3-methyl-1H-indole;N-methylmethanamine?
The InChIKey is IBHRJTTUOZMKMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H7N/c1-7-6-10-9-5-3-2-4-8(7)9;1-3-2/h2-6,10H,1H3;3H,1-2H3.
What are the key properties of 3-methyl-1H-indole;N-methylmethanamine?
3-methyl-1H-indole;N-methylmethanamine has a molecular weight of 176.26 g/mol, XLogP of 2.31, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-indole;N-methylmethanamine is sourced from PubChem (CID 68994741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).