C16H16F3NS2 — CID 171976740
4-[2-[(dimethylamino)methyl]phenyl]sulfanyl-3-(trifluoromethyl)benzenethiol (PubChem CID 171976740) has the molecular formula C16H16F3NS2 and a molecular weight of 343.44 g/mol. Its IUPAC name is 4-[2-[(dimethylamino)methyl]phenyl]sulfanyl-3-(trifluoromethyl)benzenethiol.
| Compound Name | 4-[2-[(dimethylamino)methyl]phenyl]sulfanyl-3-(trifluoromethyl)benzenethiol |
|---|---|
| PubChem CID | 171976740 |
| Molecular Formula | C16H16F3NS2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4-[2-[(dimethylamino)methyl]phenyl]sulfanyl-3-(trifluoromethyl)benzenethiol |
| SMILES | CN(C)Cc1ccccc1Sc1ccc(S)cc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NS2/c1-20(2)10-11-5-3-4-6-14(11)22-15-8-7-12(21)9-13(15)16(17,18)19/h3-9,21H,10H2,1-2H3 |
| InChIKey | VOXFFFJBOLEVIR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|