C21H29FN6O2 — CID 118591597
1-[5-[1-(4-aminobutyl)piperidin-4-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-fluoro-3-methylphenyl)urea (PubChem CID 118591597) has the molecular formula C21H29FN6O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-[5-[1-(4-aminobutyl)piperidin-4-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-fluoro-3-methylphenyl)urea.
| Compound Name | 1-[5-[1-(4-aminobutyl)piperidin-4-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-fluoro-3-methylphenyl)urea |
|---|---|
| PubChem CID | 118591597 |
| Molecular Formula | C21H29FN6O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-[5-[1-(4-aminobutyl)piperidin-4-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-fluoro-3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ncc(C3CCN(CCCCN)CC3)c(=O)[nH]2)c1F |
| InChI | InChI=1S/C21H29FN6O2/c1-14-5-4-6-17(18(14)22)25-21(30)27-20-24-13-16(19(29)26-20)15-7-11-28(12-8-15)10-3-2-9-23/h4-6,13,15H,2-3,7-12,23H2,1H3,(H3,24,25,26,27,29,30) |
| InChIKey | BMVWAQAUMPXTMG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|