C20H36F2O2 — CID 118592240
5-(2,3-difluoro-4-methoxycyclohexyl)-2-(4-methylheptyl)oxane (PubChem CID 118592240) has the molecular formula C20H36F2O2 and a molecular weight of 346.50 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-methoxycyclohexyl)-2-(4-methylheptyl)oxane.
| Compound Name | 5-(2,3-difluoro-4-methoxycyclohexyl)-2-(4-methylheptyl)oxane |
|---|---|
| PubChem CID | 118592240 |
| Molecular Formula | C20H36F2O2 |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 5-(2,3-difluoro-4-methoxycyclohexyl)-2-(4-methylheptyl)oxane |
| SMILES | CCCC(C)CCCC1CCC(C2CCC(OC)C(F)C2F)CO1 |
| InChI | InChI=1S/C20H36F2O2/c1-4-6-14(2)7-5-8-16-10-9-15(13-24-16)17-11-12-18(23-3)20(22)19(17)21/h14-20H,4-13H2,1-3H3 |
| InChIKey | SCSMKLNABYWUMB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |